C22H22F5N3O6 — CID 140867591
(2R,3R,4R,5R)-2-fluoro-5-[4-[4-fluoro-3-(trifluoromethyl)anilino]-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol (PubChem CID 140867591) has the molecular formula C22H22F5N3O6 and a molecular weight of 519.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-fluoro-5-[4-[4-fluoro-3-(trifluoromethyl)anilino]-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol.
| Compound Name | (2R,3R,4R,5R)-2-fluoro-5-[4-[4-fluoro-3-(trifluoromethyl)anilino]-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 140867591 |
| Molecular Formula | C22H22F5N3O6 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2R,3R,4R,5R)-2-fluoro-5-[4-[4-fluoro-3-(trifluoromethyl)anilino]-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol |
| SMILES | COc1cc2c(Nc3ccc(F)c(C(F)(F)F)c3)ncnc2cc1O[C@H](CO)[C@H](O)[C@@H](O)[C@H](F)CO |
| InChI | InChI=1S/C22H22F5N3O6/c1-35-16-5-11-15(6-17(16)36-18(8-32)20(34)19(33)14(24)7-31)28-9-29-21(11)30-10-2-3-13(23)12(4-10)22(25,26)27/h2-6,9,14,18-20,31-34H,7-8H2,1H3,(H,28,29,30)/t14-,18-,19+,20+/m1/s1 |
| InChIKey | OEPODWOVHNXEKY-FCDRMGDPSA-N |
| XLogP | 2.33 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |