C21H25F2N3O7 — CID 141243618
(2R,3R,4R,5R)-2-fluoro-5-[4-(4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol;hydrate (PubChem CID 141243618) has the molecular formula C21H25F2N3O7 and a molecular weight of 469.44 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-fluoro-5-[4-(4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol;hydrate.
| Compound Name | (2R,3R,4R,5R)-2-fluoro-5-[4-(4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol;hydrate |
|---|---|
| PubChem CID | 141243618 |
| Molecular Formula | C21H25F2N3O7 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (2R,3R,4R,5R)-2-fluoro-5-[4-(4-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyhexane-1,3,4,6-tetrol;hydrate |
| SMILES | COc1cc2c(Nc3ccc(F)cc3)ncnc2cc1O[C@H](CO)[C@H](O)[C@@H](O)[C@H](F)CO.O |
| InChI | InChI=1S/C21H23F2N3O6.H2O/c1-31-16-6-13-15(24-10-25-21(13)26-12-4-2-11(22)3-5-12)7-17(16)32-18(9-28)20(30)19(29)14(23)8-27;/h2-7,10,14,18-20,27-30H,8-9H2,1H3,(H,24,25,26);1H2/t14-,18-,19+,20+;/m1./s1 |
| InChIKey | FWBDPJOMNBIPGC-ZJYALLPQSA-N |
| XLogP | 0.49 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |