C36H25N5 — CID 140871988
9-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-isocyanophenyl]-2,7-diphenylcarbazole (PubChem CID 140871988) has the molecular formula C36H25N5 and a molecular weight of 527.63 g/mol. Its IUPAC name is 9-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-isocyanophenyl]-2,7-diphenylcarbazole.
| Compound Name | 9-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-isocyanophenyl]-2,7-diphenylcarbazole |
|---|---|
| PubChem CID | 140871988 |
| Molecular Formula | C36H25N5 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 9-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-isocyanophenyl]-2,7-diphenylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-n2c3cc(-c4ccccc4)ccc3c3ccc(-c4ccccc4)cc32)cc1-c1nc(C)nc(C)n1 |
| InChI | InChI=1S/C36H25N5/c1-23-38-24(2)40-36(39-23)32-22-29(16-19-33(32)37-3)41-34-20-27(25-10-6-4-7-11-25)14-17-30(34)31-18-15-28(21-35(31)41)26-12-8-5-9-13-26/h4-22H,1-2H3 |
| InChIKey | IFAHQVVSBGRDGN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|