C26H26F3N5O2 — CID 140873554
1-(2-propan-2-ylphenyl)-3-[[4-[2-[1-[2-(trifluoromethoxy)phenyl]ethylidene]hydrazinyl]phenyl]methylideneamino]urea (PubChem CID 140873554) has the molecular formula C26H26F3N5O2 and a molecular weight of 497.52 g/mol. Its IUPAC name is 1-(2-propan-2-ylphenyl)-3-[[4-[2-[1-[2-(trifluoromethoxy)phenyl]ethylidene]hydrazinyl]phenyl]methylideneamino]urea.
| Compound Name | 1-(2-propan-2-ylphenyl)-3-[[4-[2-[1-[2-(trifluoromethoxy)phenyl]ethylidene]hydrazinyl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 140873554 |
| Molecular Formula | C26H26F3N5O2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-(2-propan-2-ylphenyl)-3-[[4-[2-[1-[2-(trifluoromethoxy)phenyl]ethylidene]hydrazinyl]phenyl]methylideneamino]urea |
| SMILES | CC(=NNc1ccc(C=NNC(=O)Nc2ccccc2C(C)C)cc1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C26H26F3N5O2/c1-17(2)21-8-4-6-10-23(21)31-25(35)34-30-16-19-12-14-20(15-13-19)33-32-18(3)22-9-5-7-11-24(22)36-26(27,28)29/h4-17,33H,1-3H3,(H2,31,34,35) |
| InChIKey | WADOTWZPPDSDDS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|