C21H36FNO2SSi — CID 140876997
N-[[3-fluoro-2-[tri(propan-2-yl)silyloxymethyl]phenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 140876997) has the molecular formula C21H36FNO2SSi and a molecular weight of 413.68 g/mol. Its IUPAC name is N-[[3-fluoro-2-[tri(propan-2-yl)silyloxymethyl]phenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[[3-fluoro-2-[tri(propan-2-yl)silyloxymethyl]phenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140876997 |
| Molecular Formula | C21H36FNO2SSi |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[[3-fluoro-2-[tri(propan-2-yl)silyloxymethyl]phenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)[Si](OCc1c(F)cccc1C=NS(=O)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36FNO2SSi/c1-15(2)27(16(3)4,17(5)6)25-14-19-18(11-10-12-20(19)22)13-23-26(24)21(7,8)9/h10-13,15-17H,14H2,1-9H3 |
| InChIKey | KALYEDQRHRBHOA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|