C44H38N2O2 — CID 140877567
2-[4-bis(4-methylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3-oxocyclobutan-1-olate (PubChem CID 140877567) has the molecular formula C44H38N2O2 and a molecular weight of 626.80 g/mol. Its IUPAC name is 2-[4-bis(4-methylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3-oxocyclobutan-1-olate.
| Compound Name | 2-[4-bis(4-methylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3-oxocyclobutan-1-olate |
|---|---|
| PubChem CID | 140877567 |
| Molecular Formula | C44H38N2O2 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 2-[4-bis(4-methylphenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-3-oxocyclobutan-1-olate |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C3C(=O)C(=C4C=CC(=[N+](c5ccc(C)cc5)c5ccc(C)cc5)C=C4)C3[O-])cc2)cc1 |
| InChI | InChI=1S/C44H38N2O2/c1-29-5-17-35(18-6-29)45(36-19-7-30(2)8-20-36)39-25-13-33(14-26-39)41-43(47)42(44(41)48)34-15-27-40(28-16-34)46(37-21-9-31(3)10-22-37)38-23-11-32(4)12-24-38/h5-28,41,43H,1-4H3 |
| InChIKey | KVJWGDQPCSGOLQ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|