C16H19BCl2N2O4 — CID 140880246
[(1R)-1-[[2-[cyclopropyl(prop-2-enoyl)amino]acetyl]amino]-2-(2,4-dichlorophenyl)ethyl]boronic acid (PubChem CID 140880246) has the molecular formula C16H19BCl2N2O4 and a molecular weight of 385.06 g/mol. Its IUPAC name is [(1R)-1-[[2-[cyclopropyl(prop-2-enoyl)amino]acetyl]amino]-2-(2,4-dichlorophenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[cyclopropyl(prop-2-enoyl)amino]acetyl]amino]-2-(2,4-dichlorophenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 140880246 |
| Molecular Formula | C16H19BCl2N2O4 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [(1R)-1-[[2-[cyclopropyl(prop-2-enoyl)amino]acetyl]amino]-2-(2,4-dichlorophenyl)ethyl]boronic acid |
| SMILES | C=CC(=O)N(CC(=O)N[C@@H](Cc1ccc(Cl)cc1Cl)B(O)O)C1CC1 |
| InChI | InChI=1S/C16H19BCl2N2O4/c1-2-16(23)21(12-5-6-12)9-15(22)20-14(17(24)25)7-10-3-4-11(18)8-13(10)19/h2-4,8,12,14,24-25H,1,5-7,9H2,(H,20,22)/t14-/m0/s1 |
| InChIKey | SXPLNOWBPHDGBD-AWEZNQCLSA-N |
| XLogP | 1.21 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|