C15H16BCl2F3N2O4 — CID 140880288
[(1R)-2-(2,4-dichlorophenyl)-1-[[2-[prop-2-enoyl(2,2,2-trifluoroethyl)amino]acetyl]amino]ethyl]boronic acid (PubChem CID 140880288) has the molecular formula C15H16BCl2F3N2O4 and a molecular weight of 427.02 g/mol. Its IUPAC name is [(1R)-2-(2,4-dichlorophenyl)-1-[[2-[prop-2-enoyl(2,2,2-trifluoroethyl)amino]acetyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(2,4-dichlorophenyl)-1-[[2-[prop-2-enoyl(2,2,2-trifluoroethyl)amino]acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140880288 |
| Molecular Formula | C15H16BCl2F3N2O4 |
| Molecular Weight | 427.02 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | [(1R)-2-(2,4-dichlorophenyl)-1-[[2-[prop-2-enoyl(2,2,2-trifluoroethyl)amino]acetyl]amino]ethyl]boronic acid |
| SMILES | C=CC(=O)N(CC(=O)N[C@@H](Cc1ccc(Cl)cc1Cl)B(O)O)CC(F)(F)F |
| InChI | InChI=1S/C15H16BCl2F3N2O4/c1-2-14(25)23(8-15(19,20)21)7-13(24)22-12(16(26)27)5-9-3-4-10(17)6-11(9)18/h2-4,6,12,26-27H,1,5,7-8H2,(H,22,24)/t12-/m0/s1 |
| InChIKey | MGTYHTGYCGPLMR-LBPRGKRZSA-N |
| XLogP | 1.61 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.02 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|