C20H14F3N7O — CID 140882777
3-isocyano-N-prop-2-ynyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 140882777) has the molecular formula C20H14F3N7O and a molecular weight of 425.37 g/mol. Its IUPAC name is 3-isocyano-N-prop-2-ynyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-isocyano-N-prop-2-ynyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140882777 |
| Molecular Formula | C20H14F3N7O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3-isocyano-N-prop-2-ynyl-N-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | [C-]#[N+]c1cc(C(=O)N(CC#C)C(C)c2ncnn2-c2ncccn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F3N7O/c1-4-8-29(13(2)17-27-12-28-30(17)19-25-6-5-7-26-19)18(31)14-9-15(20(21,22)23)11-16(10-14)24-3/h1,5-7,9-13H,8H2,2H3 |
| InChIKey | NUDDNPURVCPLLP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|