C19H16F6N6O4S — CID 172561318
3-[ethyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]carbamoyl]-2,5-bis(trifluoromethyl)benzenesulfonic acid (PubChem CID 172561318) has the molecular formula C19H16F6N6O4S and a molecular weight of 538.43 g/mol. Its IUPAC name is 3-[ethyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]carbamoyl]-2,5-bis(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 3-[ethyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]carbamoyl]-2,5-bis(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 172561318 |
| Molecular Formula | C19H16F6N6O4S |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 3-[ethyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]carbamoyl]-2,5-bis(trifluoromethyl)benzenesulfonic acid |
| SMILES | CCN(C(=O)c1cc(C(F)(F)F)cc(S(=O)(=O)O)c1C(F)(F)F)C(C)c1ncnn1-c1ncccn1 |
| InChI | InChI=1S/C19H16F6N6O4S/c1-3-30(10(2)15-28-9-29-31(15)17-26-5-4-6-27-17)16(32)12-7-11(18(20,21)22)8-13(36(33,34)35)14(12)19(23,24)25/h4-10H,3H2,1-2H3,(H,33,34,35) |
| InChIKey | AAMCCEKHFBQOLH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|