C12H22O — CID 140883777
5,5-dimethyl-3,4-di(propan-2-yl)-2H-furan (PubChem CID 140883777) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 5,5-dimethyl-3,4-di(propan-2-yl)-2H-furan.
| Compound Name | 5,5-dimethyl-3,4-di(propan-2-yl)-2H-furan |
|---|---|
| PubChem CID | 140883777 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 5,5-dimethyl-3,4-di(propan-2-yl)-2H-furan |
| SMILES | CC(C)C1=C(C(C)C)C(C)(C)OC1 |
| InChI | InChI=1S/C12H22O/c1-8(2)10-7-13-12(5,6)11(10)9(3)4/h8-9H,7H2,1-6H3 |
| InChIKey | CADSUQWXCKFMNR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|