C17H19N3O — CID 140885139
(2S)-2-(4-cyclopropyl-2,3-dihydroindole-1-carbonyl)pyrrolidine-1-carbonitrile (PubChem CID 140885139) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S)-2-(4-cyclopropyl-2,3-dihydroindole-1-carbonyl)pyrrolidine-1-carbonitrile.
| Compound Name | (2S)-2-(4-cyclopropyl-2,3-dihydroindole-1-carbonyl)pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 140885139 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2S)-2-(4-cyclopropyl-2,3-dihydroindole-1-carbonyl)pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC[C@H]1C(=O)N1CCc2c(C3CC3)cccc21 |
| InChI | InChI=1S/C17H19N3O/c18-11-19-9-2-5-16(19)17(21)20-10-8-14-13(12-6-7-12)3-1-4-15(14)20/h1,3-4,12,16H,2,5-10H2/t16-/m0/s1 |
| InChIKey | AHXHFWKYIYXQMV-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|