C19H18N4O — CID 164607830
(2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile (PubChem CID 164607830) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile.
| Compound Name | (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 164607830 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC[C@H]1C(=O)N1Cc2cccc(-c3ccccn3)c2C1 |
| InChI | InChI=1S/C19H18N4O/c20-13-22-10-4-8-18(22)19(24)23-11-14-5-3-6-15(16(14)12-23)17-7-1-2-9-21-17/h1-3,5-7,9,18H,4,8,10-12H2/t18-/m0/s1 |
| InChIKey | JFHMYQLJHAVTGE-SFHVURJKSA-N |
| XLogP | 2.54 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|