About (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile
(2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile (PubChem CID 164607830) has the molecular formula C19H18N4O
and a molecular weight of 318.38 g/mol. Its IUPAC name is (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile.
Molecular Properties
| Compound Name | (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile |
| PubChem CID | 164607830 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC[C@H]1C(=O)N1Cc2cccc(-c3ccccn3)c2C1 |
| InChI | InChI=1S/C19H18N4O/c20-13-22-10-4-8-18(22)19(24)23-11-14-5-3-6-15(16(14)12-23)17-7-1-2-9-21-17/h1-3,5-7,9,18H,4,8,10-12H2/t18-/m0/s1 |
| InChIKey | JFHMYQLJHAVTGE-SFHVURJKSA-N |
| XLogP | 2.54 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile?
The IUPAC name of (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile (CID 164607830) is (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile.
What is the SMILES notation for (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile?
The canonical SMILES for (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile is N#CN1CCC[C@H]1C(=O)N1Cc2cccc(-c3ccccn3)c2C1.
What is the InChIKey of (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile?
The InChIKey is JFHMYQLJHAVTGE-SFHVURJKSA-N. The full InChI is InChI=1S/C19H18N4O/c20-13-22-10-4-8-18(22)19(24)23-11-14-5-3-6-15(16(14)12-23)17-7-1-2-9-21-17/h1-3,5-7,9,18H,4,8,10-12H2/t18-/m0/s1.
What are the key properties of (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile?
(2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile has a molecular weight of 318.38 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4-pyridin-2-yl-1,3-dihydroisoindole-2-carbonyl)pyrrolidine-1-carbonitrile is sourced from PubChem (CID 164607830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).