C46H80Si — CID 140886609
(3,6-dimethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-dimethyl-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)silane (PubChem CID 140886609) has the molecular formula C46H80Si and a molecular weight of 661.23 g/mol. Its IUPAC name is (3,6-dimethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-dimethyl-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)silane.
| Compound Name | (3,6-dimethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-dimethyl-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)silane |
|---|---|
| PubChem CID | 140886609 |
| Molecular Formula | C46H80Si |
| Molecular Weight | 661.23 g/mol |
| Exact Mass | 660.60 |
| IUPAC Name | (3,6-dimethyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl)-dimethyl-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)silane |
| SMILES | CC1CCC2C(C1)C1CC(C)CCC1C2[Si](C)(C)C1C2CC3C(CC2C2CC4C(CC21)C(C)(C)CCC4(C)C)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C46H80Si/c1-27-13-15-29-31(21-27)32-22-28(2)14-16-30(32)41(29)47(11,12)42-35-25-39-37(43(3,4)17-19-45(39,7)8)23-33(35)34-24-38-40(26-36(34)42)46(9,10)20-18-44(38,5)6/h27-42H,13-26H2,1-12H3 |
| InChIKey | FQDBZAHOWFYMDB-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.23 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|