C16H32N2O4SSi — CID 140887034
tert-butyl N-(6-methyl-3-trimethylsilylhepta-3,4-dienyl)-N-sulfamoylcarbamate (PubChem CID 140887034) has the molecular formula C16H32N2O4SSi and a molecular weight of 376.60 g/mol. Its IUPAC name is tert-butyl N-(6-methyl-3-trimethylsilylhepta-3,4-dienyl)-N-sulfamoylcarbamate.
| Compound Name | tert-butyl N-(6-methyl-3-trimethylsilylhepta-3,4-dienyl)-N-sulfamoylcarbamate |
|---|---|
| PubChem CID | 140887034 |
| Molecular Formula | C16H32N2O4SSi |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | tert-butyl N-(6-methyl-3-trimethylsilylhepta-3,4-dienyl)-N-sulfamoylcarbamate |
| SMILES | CC(C)C=C=C(CCN(C(=O)OC(C)(C)C)S(N)(=O)=O)[Si](C)(C)C |
| InChI | InChI=1S/C16H32N2O4SSi/c1-13(2)9-10-14(24(6,7)8)11-12-18(23(17,20)21)15(19)22-16(3,4)5/h9,13H,11-12H2,1-8H3,(H2,17,20,21) |
| InChIKey | VJSMSYWMTINEIR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|