C13H27ClN2O4S — CID 154708735
tert-butyl N-(tert-butylsulfamoyl)-N-(3-chlorobutyl)carbamate (PubChem CID 154708735) has the molecular formula C13H27ClN2O4S and a molecular weight of 342.89 g/mol. Its IUPAC name is tert-butyl N-(tert-butylsulfamoyl)-N-(3-chlorobutyl)carbamate.
| Compound Name | tert-butyl N-(tert-butylsulfamoyl)-N-(3-chlorobutyl)carbamate |
|---|---|
| PubChem CID | 154708735 |
| Molecular Formula | C13H27ClN2O4S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl N-(tert-butylsulfamoyl)-N-(3-chlorobutyl)carbamate |
| SMILES | CC(Cl)CCN(C(=O)OC(C)(C)C)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H27ClN2O4S/c1-10(14)8-9-16(11(17)20-13(5,6)7)21(18,19)15-12(2,3)4/h10,15H,8-9H2,1-7H3 |
| InChIKey | YGCLAWJBIFTJJX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|