C15H31Cl2N2O7PS — CID 10929003
tert-butyl N-(2-chloroethyl)-N-[2-chloroethyl(1-diethoxyphosphorylethyl)sulfamoyl]carbamate (PubChem CID 10929003) has the molecular formula C15H31Cl2N2O7PS and a molecular weight of 485.37 g/mol. Its IUPAC name is tert-butyl N-(2-chloroethyl)-N-[2-chloroethyl(1-diethoxyphosphorylethyl)sulfamoyl]carbamate.
| Compound Name | tert-butyl N-(2-chloroethyl)-N-[2-chloroethyl(1-diethoxyphosphorylethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 10929003 |
| Molecular Formula | C15H31Cl2N2O7PS |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | tert-butyl N-(2-chloroethyl)-N-[2-chloroethyl(1-diethoxyphosphorylethyl)sulfamoyl]carbamate |
| SMILES | CCOP(=O)(OCC)C(C)N(CCCl)S(=O)(=O)N(CCCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31Cl2N2O7PS/c1-7-24-27(21,25-8-2)13(3)18(11-9-16)28(22,23)19(12-10-17)14(20)26-15(4,5)6/h13H,7-12H2,1-6H3 |
| InChIKey | IPRUCIYRFDUWKV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|