C14H29ClN2O4S — CID 154708739
tert-butyl N-(tert-butylsulfamoyl)-N-(3-chloro-3-methylbutyl)carbamate (PubChem CID 154708739) has the molecular formula C14H29ClN2O4S and a molecular weight of 356.92 g/mol. Its IUPAC name is tert-butyl N-(tert-butylsulfamoyl)-N-(3-chloro-3-methylbutyl)carbamate.
| Compound Name | tert-butyl N-(tert-butylsulfamoyl)-N-(3-chloro-3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 154708739 |
| Molecular Formula | C14H29ClN2O4S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl N-(tert-butylsulfamoyl)-N-(3-chloro-3-methylbutyl)carbamate |
| SMILES | CC(C)(Cl)CCN(C(=O)OC(C)(C)C)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H29ClN2O4S/c1-12(2,3)16-22(19,20)17(10-9-14(7,8)15)11(18)21-13(4,5)6/h16H,9-10H2,1-8H3 |
| InChIKey | FBOLFAYWVZNWKM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|