C12H24N2O4S — CID 167351432
tert-butyl N-ethyl-N-[[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate (PubChem CID 167351432) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 167351432 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl N-ethyl-N-[[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate |
| SMILES | C=CC[C@H](C)NS(=O)(=O)N(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O4S/c1-7-9-10(3)13-19(16,17)14(8-2)11(15)18-12(4,5)6/h7,10,13H,1,8-9H2,2-6H3/t10-/m0/s1 |
| InChIKey | KNLUCZYQWQAZKL-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|