C17H33NO4SSi — CID 10045024
tert-butyl N-hepta-1,6-dien-4-yl-N-(2-trimethylsilylethylsulfonyl)carbamate (PubChem CID 10045024) has the molecular formula C17H33NO4SSi and a molecular weight of 375.61 g/mol. Its IUPAC name is tert-butyl N-hepta-1,6-dien-4-yl-N-(2-trimethylsilylethylsulfonyl)carbamate.
| Compound Name | tert-butyl N-hepta-1,6-dien-4-yl-N-(2-trimethylsilylethylsulfonyl)carbamate |
|---|---|
| PubChem CID | 10045024 |
| Molecular Formula | C17H33NO4SSi |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl N-hepta-1,6-dien-4-yl-N-(2-trimethylsilylethylsulfonyl)carbamate |
| SMILES | C=CCC(CC=C)N(C(=O)OC(C)(C)C)S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C17H33NO4SSi/c1-9-11-15(12-10-2)18(16(19)22-17(3,4)5)23(20,21)13-14-24(6,7)8/h9-10,15H,1-2,11-14H2,3-8H3 |
| InChIKey | LKKNZDQXOKAAPL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|