C29H48N2O8SSi — CID 163283786
tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethylsulfonyl)amino]methyl]-2-(phenylmethoxycarbonylamino)hex-5-enoate (PubChem CID 163283786) has the molecular formula C29H48N2O8SSi and a molecular weight of 612.86 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethylsulfonyl)amino]methyl]-2-(phenylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethylsulfonyl)amino]methyl]-2-(phenylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 163283786 |
| Molecular Formula | C29H48N2O8SSi |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethylsulfonyl)amino]methyl]-2-(phenylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CC[C@H](CN(C(=O)OC(C)(C)C)S(=O)(=O)CC[Si](C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H48N2O8SSi/c1-11-15-23(20-31(27(34)39-29(5,6)7)40(35,36)18-19-41(8,9)10)24(25(32)38-28(2,3)4)30-26(33)37-21-22-16-13-12-14-17-22/h11-14,16-17,23-24H,1,15,18-21H2,2-10H3,(H,30,33)/t23-,24+/m1/s1 |
| InChIKey | PWQGMYYOYUPFGO-RPWUZVMVSA-N |
| XLogP | 5.72 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|