C20H29NO7S — CID 155589062
tert-butyl (2S,3S)-3-(methylsulfonyloxymethyl)-2-(phenylmethoxycarbonylamino)hex-5-enoate (PubChem CID 155589062) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-(methylsulfonyloxymethyl)-2-(phenylmethoxycarbonylamino)hex-5-enoate.
| Compound Name | tert-butyl (2S,3S)-3-(methylsulfonyloxymethyl)-2-(phenylmethoxycarbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 155589062 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl (2S,3S)-3-(methylsulfonyloxymethyl)-2-(phenylmethoxycarbonylamino)hex-5-enoate |
| SMILES | C=CC[C@H](COS(C)(=O)=O)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO7S/c1-6-10-16(14-27-29(5,24)25)17(18(22)28-20(2,3)4)21-19(23)26-13-15-11-8-7-9-12-15/h6-9,11-12,16-17H,1,10,13-14H2,2-5H3,(H,21,23)/t16-,17+/m1/s1 |
| InChIKey | YAFQEKVCDWFVEZ-SJORKVTESA-N |
| XLogP | 2.79 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|