C11H22N2O4S — CID 130367367
tert-butyl N-but-3-enyl-N-(ethylsulfamoyl)carbamate (PubChem CID 130367367) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-(ethylsulfamoyl)carbamate.
| Compound Name | tert-butyl N-but-3-enyl-N-(ethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 130367367 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-(ethylsulfamoyl)carbamate |
| SMILES | C=CCCN(C(=O)OC(C)(C)C)S(=O)(=O)NCC |
| InChI | InChI=1S/C11H22N2O4S/c1-6-8-9-13(18(15,16)12-7-2)10(14)17-11(3,4)5/h6,12H,1,7-9H2,2-5H3 |
| InChIKey | DPEOTGXFYLHNFD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|