C9H16ClN3O4S — CID 101088085
tert-butyl N-(2-chloroethylsulfamoyl)-N-(cyanomethyl)carbamate (PubChem CID 101088085) has the molecular formula C9H16ClN3O4S and a molecular weight of 297.76 g/mol. Its IUPAC name is tert-butyl N-(2-chloroethylsulfamoyl)-N-(cyanomethyl)carbamate.
| Compound Name | tert-butyl N-(2-chloroethylsulfamoyl)-N-(cyanomethyl)carbamate |
|---|---|
| PubChem CID | 101088085 |
| Molecular Formula | C9H16ClN3O4S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | tert-butyl N-(2-chloroethylsulfamoyl)-N-(cyanomethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC#N)S(=O)(=O)NCCCl |
| InChI | InChI=1S/C9H16ClN3O4S/c1-9(2,3)17-8(14)13(7-5-11)18(15,16)12-6-4-10/h12H,4,6-7H2,1-3H3 |
| InChIKey | DSIJFFBANJSIPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|