C13H30N2O5SSi — CID 101437485
tert-butyl N-[[tert-butyl(dimethyl)silyl]oxysulfamoyl]-N-ethylcarbamate (PubChem CID 101437485) has the molecular formula C13H30N2O5SSi and a molecular weight of 354.55 g/mol. Its IUPAC name is tert-butyl N-[[tert-butyl(dimethyl)silyl]oxysulfamoyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[tert-butyl(dimethyl)silyl]oxysulfamoyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 101437485 |
| Molecular Formula | C13H30N2O5SSi |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[[tert-butyl(dimethyl)silyl]oxysulfamoyl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)S(=O)(=O)NO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30N2O5SSi/c1-10-15(11(16)19-12(2,3)4)21(17,18)14-20-22(8,9)13(5,6)7/h14H,10H2,1-9H3 |
| InChIKey | OLWOGIPTVSXNOC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|