C22H19N6+ — CID 140891392
1-[5-(4-pyrazol-1-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carbonitrile (PubChem CID 140891392) has the molecular formula C22H19N6+ and a molecular weight of 367.44 g/mol. Its IUPAC name is 1-[5-(4-pyrazol-1-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carbonitrile.
| Compound Name | 1-[5-(4-pyrazol-1-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 140891392 |
| Molecular Formula | C22H19N6+ |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[5-(4-pyrazol-1-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2,3,4,5-tetrahydropyridin-1-ium-4-carbonitrile |
| SMILES | N#CC1CC=[N+](c2c(-c3ccc(-n4cccn4)cc3)cnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C22H19N6/c23-14-16-7-12-27(13-8-16)21-19-6-10-24-22(19)25-15-20(21)17-2-4-18(5-3-17)28-11-1-9-26-28/h1-6,9-12,15-16H,7-8,13H2,(H,24,25)/q+1 |
| InChIKey | NQMMGGFZDJILTJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|