C11H21N3O4S — CID 140895544
(3S,5S)-5-[[(2R)-2-aminocyclohexyl]carbamoyl]pyrrolidine-3-sulfonic acid (PubChem CID 140895544) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is (3S,5S)-5-[[(2R)-2-aminocyclohexyl]carbamoyl]pyrrolidine-3-sulfonic acid.
| Compound Name | (3S,5S)-5-[[(2R)-2-aminocyclohexyl]carbamoyl]pyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 140895544 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (3S,5S)-5-[[(2R)-2-aminocyclohexyl]carbamoyl]pyrrolidine-3-sulfonic acid |
| SMILES | N[C@@H]1CCCCC1NC(=O)[C@@H]1C[C@H](S(=O)(=O)O)CN1 |
| InChI | InChI=1S/C11H21N3O4S/c12-8-3-1-2-4-9(8)14-11(15)10-5-7(6-13-10)19(16,17)18/h7-10,13H,1-6,12H2,(H,14,15)(H,16,17,18)/t7-,8+,9?,10-/m0/s1 |
| InChIKey | MLVGWQINEJMNGD-WPXGONGXSA-N |
| XLogP | -1.01 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|