C7H15N2O3P — CID 70341778
[(1S,2R)-2-aminocyclohexyl]carbamoylphosphonous acid (PubChem CID 70341778) has the molecular formula C7H15N2O3P and a molecular weight of 206.18 g/mol. Its IUPAC name is [(1S,2R)-2-aminocyclohexyl]carbamoylphosphonous acid.
| Compound Name | [(1S,2R)-2-aminocyclohexyl]carbamoylphosphonous acid |
|---|---|
| PubChem CID | 70341778 |
| Molecular Formula | C7H15N2O3P |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [(1S,2R)-2-aminocyclohexyl]carbamoylphosphonous acid |
| SMILES | N[C@@H]1CCCC[C@@H]1NC(=O)P(O)O |
| InChI | InChI=1S/C7H15N2O3P/c8-5-3-1-2-4-6(5)9-7(10)13(11)12/h5-6,11-12H,1-4,8H2,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | UFOYSIMPNBBQQG-RITPCOANSA-N |
| XLogP | 0.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|