C12H20N2O3 — CID 76993018
4-[(2-aminocyclohexyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76993018) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-[(2-aminocyclohexyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2-aminocyclohexyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76993018 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-[(2-aminocyclohexyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC1CCCCC1N |
| InChI | InChI=1S/C12H20N2O3/c1-7(8(2)12(16)17)11(15)14-10-6-4-3-5-9(10)13/h9-10H,3-6,13H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | VMDODWQLYPFNGE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|