C17H13BrN2O5S — CID 140896937
(5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1H-pyridin-4-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140896937) has the molecular formula C17H13BrN2O5S and a molecular weight of 437.27 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1H-pyridin-4-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1H-pyridin-4-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140896937 |
| Molecular Formula | C17H13BrN2O5S |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1H-pyridin-4-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C\c2cc(OCc3cc[nH]c(=O)c3)c(O)cc2Br)C1=O |
| InChI | InChI=1S/C17H13BrN2O5S/c1-20-16(23)14(26-17(20)24)6-10-5-13(12(21)7-11(10)18)25-8-9-2-3-19-15(22)4-9/h2-7,21H,8H2,1H3,(H,19,22)/b14-6- |
| InChIKey | XNOALLPSPKFSBN-NSIKDUERSA-N |
| XLogP | 3.09 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|