C9H16O8 — CID 140898583
(3R,4R,5S,6R,8S)-3-deuterio-4,5,6,8,9-pentahydroxy-2-oxononanoic acid (PubChem CID 140898583) has the molecular formula C9H16O8 and a molecular weight of 253.23 g/mol. Its IUPAC name is (3R,4R,5S,6R,8S)-3-deuterio-4,5,6,8,9-pentahydroxy-2-oxononanoic acid.
| Compound Name | (3R,4R,5S,6R,8S)-3-deuterio-4,5,6,8,9-pentahydroxy-2-oxononanoic acid |
|---|---|
| PubChem CID | 140898583 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (3R,4R,5S,6R,8S)-3-deuterio-4,5,6,8,9-pentahydroxy-2-oxononanoic acid |
| SMILES | [2H][C@@H](C(=O)C(=O)O)[C@@H](O)[C@@H](O)[C@H](O)C[C@H](O)CO |
| InChI | InChI=1S/C9H16O8/c10-3-4(11)1-5(12)8(15)6(13)2-7(14)9(16)17/h4-6,8,10-13,15H,1-3H2,(H,16,17)/t4-,5+,6+,8-/m0/s1/i2D/t2-,4+,5-,6-,8+/m1 |
| InChIKey | UBIIOWVLJFMUQZ-GLUQMMJESA-N |
| XLogP | -3.14 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|