C42H40BrN3O9S — CID 140899188
5-[3-[3-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]propoxy]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 140899188) has the molecular formula C42H40BrN3O9S and a molecular weight of 842.76 g/mol. Its IUPAC name is 5-[3-[3-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]propoxy]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[3-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]propoxy]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 140899188 |
| Molecular Formula | C42H40BrN3O9S |
| Molecular Weight | 842.76 g/mol |
| Exact Mass | 841.17 |
| IUPAC Name | 5-[3-[3-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]propoxy]propoxy]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCOCCCOCCCOc4ccc(Oc5c(-c6ccc(Br)cc6)sc6cc(O)ccc56)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C42H40BrN3O9S/c43-27-6-4-26(5-7-27)39-38(33-15-9-29(47)25-36(33)56-39)55-31-12-10-30(11-13-31)54-23-3-22-53-21-2-20-52-19-1-18-44-28-8-14-32-34(24-28)42(51)46(41(32)50)35-16-17-37(48)45-40(35)49/h4-15,24-25,35,44,47H,1-3,16-23H2,(H,45,48,49) |
| InChIKey | LVVCWNJTRTUFTG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|