C39H36BrN3O8S — CID 140899192
3-[6-[2-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140899192) has the molecular formula C39H36BrN3O8S and a molecular weight of 786.70 g/mol. Its IUPAC name is 3-[6-[2-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140899192 |
| Molecular Formula | C39H36BrN3O8S |
| Molecular Weight | 786.70 g/mol |
| Exact Mass | 785.14 |
| IUPAC Name | 3-[6-[2-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(NCCOCCOCCOc4ccc(Oc5c(-c6ccc(Br)cc6)sc6cc(O)ccc56)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H36BrN3O8S/c40-26-3-1-24(2-4-26)37-36(32-12-6-28(44)22-34(32)52-37)51-30-9-7-29(8-10-30)50-20-19-49-18-17-48-16-15-41-27-5-11-31-25(21-27)23-43(39(31)47)33-13-14-35(45)42-38(33)46/h1-12,21-22,33,41,44H,13-20,23H2,(H,42,45,46) |
| InChIKey | ZTNXSFOBWBAFMO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|