C40H38BrN3O8S — CID 135278284
3-[6-[3-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 135278284) has the molecular formula C40H38BrN3O8S and a molecular weight of 800.73 g/mol. Its IUPAC name is 3-[6-[3-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 135278284 |
| Molecular Formula | C40H38BrN3O8S |
| Molecular Weight | 800.73 g/mol |
| Exact Mass | 799.16 |
| IUPAC Name | 3-[6-[3-[2-[2-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenoxy]ethoxy]ethoxy]propylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(NCCCOCCOCCOc4ccc(Oc5c(-c6ccc(Br)cc6)sc6cc(O)ccc56)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H38BrN3O8S/c41-27-4-2-25(3-5-27)38-37(33-13-7-29(45)23-35(33)53-38)52-31-10-8-30(9-11-31)51-21-20-50-19-18-49-17-1-16-42-28-6-12-32-26(22-28)24-44(40(32)48)34-14-15-36(46)43-39(34)47/h2-13,22-23,34,42,45H,1,14-21,24H2,(H,43,46,47) |
| InChIKey | KQTAKYFWUVWYEC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.73 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|