C45H47BrN4O5S — CID 147023179
3-[6-[4-[4-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]propyl]-1,4-diazepan-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 147023179) has the molecular formula C45H47BrN4O5S and a molecular weight of 835.87 g/mol. Its IUPAC name is 3-[6-[4-[4-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]propyl]-1,4-diazepan-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]propyl]-1,4-diazepan-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147023179 |
| Molecular Formula | C45H47BrN4O5S |
| Molecular Weight | 835.87 g/mol |
| Exact Mass | 834.25 |
| IUPAC Name | 3-[6-[4-[4-[3-[4-[[2-(4-bromophenyl)-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]propyl]-1,4-diazepan-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CCCCN4CCCN(CCCc5ccc(Oc6c(-c7ccc(Br)cc7)sc7cc(O)ccc67)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C45H47BrN4O5S/c46-34-12-10-32(11-13-34)43-42(38-18-14-35(51)28-40(38)56-43)55-36-15-7-30(8-16-36)6-3-22-49-24-4-23-48(25-26-49)21-2-1-5-31-9-17-37-33(27-31)29-50(45(37)54)39-19-20-41(52)47-44(39)53/h7-18,27-28,39,51H,1-6,19-26,29H2,(H,47,52,53) |
| InChIKey | AWCVHWSYZXXEQY-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.87 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|