C17H35N5O2 — CID 140900438
1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea (PubChem CID 140900438) has the molecular formula C17H35N5O2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea.
| Compound Name | 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea |
|---|---|
| PubChem CID | 140900438 |
| Molecular Formula | C17H35N5O2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 1-[4-(butylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea |
| SMILES | CCCCNC1CC(C)NC(NC(=O)NC2CCC(OC)CC2)N1 |
| InChI | InChI=1S/C17H35N5O2/c1-4-5-10-18-15-11-12(2)19-16(21-15)22-17(23)20-13-6-8-14(24-3)9-7-13/h12-16,18-19,21H,4-11H2,1-3H3,(H2,20,22,23) |
| InChIKey | KTABKXZEBAZIHA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|