C17H36N6O2 — CID 140900451
1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea (PubChem CID 140900451) has the molecular formula C17H36N6O2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea.
| Compound Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea |
|---|---|
| PubChem CID | 140900451 |
| Molecular Formula | C17H36N6O2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1-[4-(4-aminobutylamino)-6-methyl-1,3-diazinan-2-yl]-3-(4-methoxycyclohexyl)urea |
| SMILES | COC1CCC(NC(=O)NC2NC(C)CC(NCCCCN)N2)CC1 |
| InChI | InChI=1S/C17H36N6O2/c1-12-11-15(19-10-4-3-9-18)22-16(20-12)23-17(24)21-13-5-7-14(25-2)8-6-13/h12-16,19-20,22H,3-11,18H2,1-2H3,(H2,21,23,24) |
| InChIKey | JQQICVSWUJOSDX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|