C13H22ClF3N4O2 — CID 140900546
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 140900546) has the molecular formula C13H22ClF3N4O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 140900546 |
| Molecular Formula | C13H22ClF3N4O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CC1CC(Cl)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C13H22ClF3N4O2/c1-7-6-10(14)20-11(18-7)21-12(22)19-8-2-4-9(5-3-8)23-13(15,16)17/h7-11,18,20H,2-6H2,1H3,(H2,19,21,22) |
| InChIKey | NXUTZVVXYIXJMT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|