C15H26ClF3N4O2 — CID 142295334
1-(4-chloro-6-propan-2-yl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 142295334) has the molecular formula C15H26ClF3N4O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is 1-(4-chloro-6-propan-2-yl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-(4-chloro-6-propan-2-yl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 142295334 |
| Molecular Formula | C15H26ClF3N4O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(4-chloro-6-propan-2-yl-1,3-diazinan-2-yl)-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CC(C)C1CC(Cl)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C15H26ClF3N4O2/c1-8(2)11-7-12(16)22-13(21-11)23-14(24)20-9-3-5-10(6-4-9)25-15(17,18)19/h8-13,21-22H,3-7H2,1-2H3,(H2,20,23,24) |
| InChIKey | LMIGJHIKIPAZFO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|