C20H39F3N6O2 — CID 142295347
1-[4-[3-(dimethylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 142295347) has the molecular formula C20H39F3N6O2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 142295347 |
| Molecular Formula | C20H39F3N6O2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propylamino]-6-propan-2-yl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CC(C)C1CC(NCCCN(C)C)NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)N1 |
| InChI | InChI=1S/C20H39F3N6O2/c1-13(2)16-12-17(24-10-5-11-29(3)4)27-18(26-16)28-19(30)25-14-6-8-15(9-7-14)31-20(21,22)23/h13-18,24,26-27H,5-12H2,1-4H3,(H2,25,28,30) |
| InChIKey | VSEUNNHBXQFPJJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|