C25H25N3O6 — CID 140902608
3-[3-oxo-7-[[4-[(2,2,3,3,6-pentadeuterio-5-oxomorpholin-4-yl)methyl]phenyl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140902608) has the molecular formula C25H25N3O6 and a molecular weight of 468.52 g/mol. Its IUPAC name is 3-[3-oxo-7-[[4-[(2,2,3,3,6-pentadeuterio-5-oxomorpholin-4-yl)methyl]phenyl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[[4-[(2,2,3,3,6-pentadeuterio-5-oxomorpholin-4-yl)methyl]phenyl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140902608 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-[3-oxo-7-[[4-[(2,2,3,3,6-pentadeuterio-5-oxomorpholin-4-yl)methyl]phenyl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1OC([2H])([2H])C([2H])([2H])N(Cc2ccc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)C1=O |
| InChI | InChI=1S/C25H25N3O6/c29-22-9-8-20(24(31)26-22)28-13-19-18(25(28)32)2-1-3-21(19)34-14-17-6-4-16(5-7-17)12-27-10-11-33-15-23(27)30/h1-7,20H,8-15H2,(H,26,29,31)/i10D2,11D2,15D |
| InChIKey | JZONBJVJFSBKMY-FPQCMJPGSA-N |
| XLogP | 1.39 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|