C25H22B5N3O5 — CID 144674037
CID 144674037 (PubChem CID 144674037) has the molecular formula C25H22B5N3O5 and a molecular weight of 498.53 g/mol.
| Compound Name | CID 144674037 |
|---|---|
| PubChem CID | 144674037 |
| Molecular Formula | C25H22B5N3O5 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | — |
| SMILES | [B]C1OC([B])C([B])([B])N(Cc2ccc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)C1[B] |
| InChI | InChI=1S/C25H22B5N3O5/c26-20-21(27)38-24(28)25(29,30)33(20)10-13-4-6-14(7-5-13)12-37-18-3-1-2-15-16(18)11-32(23(15)36)17-8-9-19(34)31-22(17)35/h1-7,17,20-21,24H,8-12H2,(H,31,34,35) |
| InChIKey | ZQBCPHBVBCHVIN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|