C25H23B2N3O6 — CID 142407170
CID 142407170 (PubChem CID 142407170) has the molecular formula C25H23B2N3O6 and a molecular weight of 483.10 g/mol.
| Compound Name | CID 142407170 |
|---|---|
| PubChem CID | 142407170 |
| Molecular Formula | C25H23B2N3O6 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | — |
| SMILES | [B]C1OCC([B])N(Cc2ccc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)C1=O |
| InChI | InChI=1S/C25H23B2N3O6/c26-20-13-36-22(27)25(34)30(20)10-14-4-6-15(7-5-14)12-35-19-3-1-2-16-17(19)11-29(24(16)33)18-8-9-21(31)28-23(18)32/h1-7,18,20,22H,8-13H2,(H,28,31,32) |
| InChIKey | DGEXKBQUKIHFNT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|