C15H18N2 — CID 14090369
3-[2-(3,4-dihydro-2H-pyridin-1-yl)ethyl]-1H-indole (PubChem CID 14090369) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-2H-pyridin-1-yl)ethyl]-1H-indole.
| Compound Name | 3-[2-(3,4-dihydro-2H-pyridin-1-yl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 14090369 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-[2-(3,4-dihydro-2H-pyridin-1-yl)ethyl]-1H-indole |
| SMILES | C1=CN(CCc2c[nH]c3ccccc23)CCC1 |
| InChI | InChI=1S/C15H18N2/c1-4-9-17(10-5-1)11-8-13-12-16-15-7-3-2-6-14(13)15/h2-4,6-7,9,12,16H,1,5,8,10-11H2 |
| InChIKey | YMZMCWYFLJMPAX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |