C14H18N2 — CID 166106987
3-(2,2-dideuterio-2-pyrrolidin-1-ylethyl)-1H-indole (PubChem CID 166106987) has the molecular formula C14H18N2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-(2,2-dideuterio-2-pyrrolidin-1-ylethyl)-1H-indole.
| Compound Name | 3-(2,2-dideuterio-2-pyrrolidin-1-ylethyl)-1H-indole |
|---|---|
| PubChem CID | 166106987 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(2,2-dideuterio-2-pyrrolidin-1-ylethyl)-1H-indole |
| SMILES | [2H]C([2H])(Cc1c[nH]c2ccccc12)N1CCCC1 |
| InChI | InChI=1S/C14H18N2/c1-2-6-14-13(5-1)12(11-15-14)7-10-16-8-3-4-9-16/h1-2,5-6,11,15H,3-4,7-10H2/i10D2 |
| InChIKey | CVTZCBLFHNGYDQ-KBMKNGFXSA-N |
| XLogP | 2.81 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |