C17H26FN4O9S- — CID 140903975
[(2S,5R)-2-[[(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 140903975) has the molecular formula C17H26FN4O9S- and a molecular weight of 481.48 g/mol. Its IUPAC name is [(2S,5R)-2-[[(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | [(2S,5R)-2-[[(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 140903975 |
| Molecular Formula | C17H26FN4O9S- |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | [(2S,5R)-2-[[(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H27FN4O9S/c1-17(2,3)30-16(25)20-7-10(18)6-12(20)9-29-19-14(23)13-5-4-11-8-21(13)15(24)22(11)31-32(26,27)28/h10-13H,4-9H2,1-3H3,(H,19,23)(H,26,27,28)/p-1/t10-,11+,12-,13-/m0/s1 |
| InChIKey | WLIMBIVJBMDNNY-RNJOBUHISA-M |
| XLogP | 0.04 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|