C17H27FN4O6 — CID 140903978
tert-butyl 4-fluoro-2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 140903978) has the molecular formula C17H27FN4O6 and a molecular weight of 402.42 g/mol. Its IUPAC name is tert-butyl 4-fluoro-2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140903978 |
| Molecular Formula | C17H27FN4O6 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tert-butyl 4-fluoro-2-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)CC1CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C17H27FN4O6/c1-17(2,3)28-16(25)20-7-10(18)6-12(20)9-27-19-14(23)13-5-4-11-8-21(13)15(24)22(11)26/h10-13,26H,4-9H2,1-3H3,(H,19,23)/t10?,11-,12?,13+/m1/s1 |
| InChIKey | CBUFEQWXEVOSBF-KPFVRQRISA-N |
| XLogP | 1.04 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|