C17H27FN4O9S — CID 140903976
tert-butyl (2S,4S)-4-fluoro-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 140903976) has the molecular formula C17H27FN4O9S and a molecular weight of 482.49 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140903976 |
| Molecular Formula | C17H27FN4O9S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H27FN4O9S/c1-17(2,3)30-16(25)20-7-10(18)6-12(20)9-29-19-14(23)13-5-4-11-8-21(13)15(24)22(11)31-32(26,27)28/h10-13H,4-9H2,1-3H3,(H,19,23)(H,26,27,28)/t10-,11+,12-,13-/m0/s1 |
| InChIKey | WLIMBIVJBMDNNY-RNJOBUHISA-N |
| XLogP | 0.38 |
| TPSA | 155.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|