C14H16Cl2N2O3 — CID 140908351
4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-4-oxobutanoic acid (PubChem CID 140908351) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 140908351 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[2-(3,5-dichlorophenyl)piperazin-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCNCC1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-10-5-9(6-11(16)7-10)12-8-17-3-4-18(12)13(19)1-2-14(20)21/h5-7,12,17H,1-4,8H2,(H,20,21) |
| InChIKey | BMDARBUWZRLJCS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |