C66H52N4O2 — CID 140908638
4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methylfuran-2-yl)-5-(5-methyl-4-phenyl-2-pyridinyl)phenyl]aniline (PubChem CID 140908638) has the molecular formula C66H52N4O2 and a molecular weight of 933.17 g/mol. Its IUPAC name is 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methylfuran-2-yl)-5-(5-methyl-4-phenyl-2-pyridinyl)phenyl]aniline.
| Compound Name | 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methylfuran-2-yl)-5-(5-methyl-4-phenyl-2-pyridinyl)phenyl]aniline |
|---|---|
| PubChem CID | 140908638 |
| Molecular Formula | C66H52N4O2 |
| Molecular Weight | 933.17 g/mol |
| Exact Mass | 932.41 |
| IUPAC Name | 4-carbazol-9-yl-2,6-dimethyl-N,N-bis[3-(5-methylfuran-2-yl)-5-(5-methyl-4-phenyl-2-pyridinyl)phenyl]aniline |
| SMILES | Cc1ccc(-c2cc(-c3cc(-c4ccccc4)c(C)cn3)cc(N(c3cc(-c4cc(-c5ccccc5)c(C)cn4)cc(-c4ccc(C)o4)c3)c3c(C)cc(-n4c5ccccc5c5ccccc54)cc3C)c2)o1 |
| InChI | InChI=1S/C66H52N4O2/c1-41-29-53(70-62-23-15-13-21-56(62)57-22-14-16-24-63(57)70)30-42(2)66(41)69(54-33-49(31-51(35-54)64-27-25-45(5)71-64)60-37-58(43(3)39-67-60)47-17-9-7-10-18-47)55-34-50(32-52(36-55)65-28-26-46(6)72-65)61-38-59(44(4)40-68-61)48-19-11-8-12-20-48/h7-40H,1-6H3 |
| InChIKey | MHBGDAFQRXTAEV-UHFFFAOYSA-N |
| XLogP | 18.08 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.17 |
| LogP ≤ 5 | 18.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |